C18H20N2O4 — CID 831096
N-[(2,4-dimethoxyphenyl)methylideneamino]-2-(2-methylphenoxy)acetamide (PubChem CID 831096) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methylideneamino]-2-(2-methylphenoxy)acetamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methylideneamino]-2-(2-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 831096 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methylideneamino]-2-(2-methylphenoxy)acetamide |
| SMILES | COc1ccc(C=NNC(=O)COc2ccccc2C)c(OC)c1 |
| InChI | InChI=1S/C18H20N2O4/c1-13-6-4-5-7-16(13)24-12-18(21)20-19-11-14-8-9-15(22-2)10-17(14)23-3/h4-11H,12H2,1-3H3,(H,20,21) |
| InChIKey | DOVXDVCJLSKQKR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|