About 2-[(1-methyl-2-oxo-3,4-dihydroquinolin-4-yl)amino]ethylurea
2-[(1-methyl-2-oxo-3,4-dihydroquinolin-4-yl)amino]ethylurea (PubChem CID 83110177) has the molecular formula C13H18N4O2
and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-[(1-methyl-2-oxo-3,4-dihydroquinolin-4-yl)amino]ethylurea.
Molecular Properties
| Compound Name | 2-[(1-methyl-2-oxo-3,4-dihydroquinolin-4-yl)amino]ethylurea |
| PubChem CID | 83110177 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-[(1-methyl-2-oxo-3,4-dihydroquinolin-4-yl)amino]ethylurea |
| SMILES | CN1C(=O)CC(NCCNC(N)=O)c2ccccc21 |
| InChI | InChI=1S/C13H18N4O2/c1-17-11-5-3-2-4-9(11)10(8-12(17)18)15-6-7-16-13(14)19/h2-5,10,15H,6-8H2,1H3,(H3,14,16,19) |
| InChIKey | OJHGNHRXSUYZEX-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1-methyl-2-oxo-3,4-dihydroquinolin-4-yl)amino]ethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-methyl-2-oxo-3,4-dihydroquinolin-4-yl)amino]ethylurea?
The IUPAC name of 2-[(1-methyl-2-oxo-3,4-dihydroquinolin-4-yl)amino]ethylurea (CID 83110177) is 2-[(1-methyl-2-oxo-3,4-dihydroquinolin-4-yl)amino]ethylurea.
What is the SMILES notation for 2-[(1-methyl-2-oxo-3,4-dihydroquinolin-4-yl)amino]ethylurea?
The canonical SMILES for 2-[(1-methyl-2-oxo-3,4-dihydroquinolin-4-yl)amino]ethylurea is CN1C(=O)CC(NCCNC(N)=O)c2ccccc21.
What is the InChIKey of 2-[(1-methyl-2-oxo-3,4-dihydroquinolin-4-yl)amino]ethylurea?
The InChIKey is OJHGNHRXSUYZEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O2/c1-17-11-5-3-2-4-9(11)10(8-12(17)18)15-6-7-16-13(14)19/h2-5,10,15H,6-8H2,1H3,(H3,14,16,19).
What are the key properties of 2-[(1-methyl-2-oxo-3,4-dihydroquinolin-4-yl)amino]ethylurea?
2-[(1-methyl-2-oxo-3,4-dihydroquinolin-4-yl)amino]ethylurea has a molecular weight of 262.31 g/mol, XLogP of 0.35, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-methyl-2-oxo-3,4-dihydroquinolin-4-yl)amino]ethylurea is sourced from PubChem (CID 83110177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).