About 1-(1,1-dioxothiolan-3-yl)-3-(5-fluoro-2-pyridinyl)pyrazole-4-carbaldehyde
1-(1,1-dioxothiolan-3-yl)-3-(5-fluoro-2-pyridinyl)pyrazole-4-carbaldehyde (PubChem CID 83110901) has the molecular formula C13H12FN3O3S
and a molecular weight of 309.32 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-(5-fluoro-2-pyridinyl)pyrazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-(5-fluoro-2-pyridinyl)pyrazole-4-carbaldehyde |
| PubChem CID | 83110901 |
| Molecular Formula | C13H12FN3O3S |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-(5-fluoro-2-pyridinyl)pyrazole-4-carbaldehyde |
| SMILES | O=Cc1cn(C2CCS(=O)(=O)C2)nc1-c1ccc(F)cn1 |
| InChI | InChI=1S/C13H12FN3O3S/c14-10-1-2-12(15-5-10)13-9(7-18)6-17(16-13)11-3-4-21(19,20)8-11/h1-2,5-7,11H,3-4,8H2 |
| InChIKey | JEABDHJVTDNLOK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 81.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,1-dioxothiolan-3-yl)-3-(5-fluoro-2-pyridinyl)pyrazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-dioxothiolan-3-yl)-3-(5-fluoro-2-pyridinyl)pyrazole-4-carbaldehyde?
The IUPAC name of 1-(1,1-dioxothiolan-3-yl)-3-(5-fluoro-2-pyridinyl)pyrazole-4-carbaldehyde (CID 83110901) is 1-(1,1-dioxothiolan-3-yl)-3-(5-fluoro-2-pyridinyl)pyrazole-4-carbaldehyde.
What is the SMILES notation for 1-(1,1-dioxothiolan-3-yl)-3-(5-fluoro-2-pyridinyl)pyrazole-4-carbaldehyde?
The canonical SMILES for 1-(1,1-dioxothiolan-3-yl)-3-(5-fluoro-2-pyridinyl)pyrazole-4-carbaldehyde is O=Cc1cn(C2CCS(=O)(=O)C2)nc1-c1ccc(F)cn1.
What is the InChIKey of 1-(1,1-dioxothiolan-3-yl)-3-(5-fluoro-2-pyridinyl)pyrazole-4-carbaldehyde?
The InChIKey is JEABDHJVTDNLOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FN3O3S/c14-10-1-2-12(15-5-10)13-9(7-18)6-17(16-13)11-3-4-21(19,20)8-11/h1-2,5-7,11H,3-4,8H2.
What are the key properties of 1-(1,1-dioxothiolan-3-yl)-3-(5-fluoro-2-pyridinyl)pyrazole-4-carbaldehyde?
1-(1,1-dioxothiolan-3-yl)-3-(5-fluoro-2-pyridinyl)pyrazole-4-carbaldehyde has a molecular weight of 309.32 g/mol, XLogP of 1.26, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-dioxothiolan-3-yl)-3-(5-fluoro-2-pyridinyl)pyrazole-4-carbaldehyde is sourced from PubChem (CID 83110901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).