C12H25N3O — CID 83111793
2-[(4-propylcyclohexyl)amino]ethylurea (PubChem CID 83111793) has the molecular formula C12H25N3O and a molecular weight of 227.35 g/mol. Its IUPAC name is 2-[(4-propylcyclohexyl)amino]ethylurea.
| Compound Name | 2-[(4-propylcyclohexyl)amino]ethylurea |
|---|---|
| PubChem CID | 83111793 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | 2-[(4-propylcyclohexyl)amino]ethylurea |
| SMILES | CCCC1CCC(NCCNC(N)=O)CC1 |
| InChI | InChI=1S/C12H25N3O/c1-2-3-10-4-6-11(7-5-10)14-8-9-15-12(13)16/h10-11,14H,2-9H2,1H3,(H3,13,15,16) |
| InChIKey | TUWSVTUOUBELQY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|