C10H15N7O2 — CID 83112049
1,1-dimethyl-3-[2-[(3-oxo-2H-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]ethyl]urea (PubChem CID 83112049) has the molecular formula C10H15N7O2 and a molecular weight of 265.28 g/mol. Its IUPAC name is 1,1-dimethyl-3-[2-[(3-oxo-2H-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]ethyl]urea.
| Compound Name | 1,1-dimethyl-3-[2-[(3-oxo-2H-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]ethyl]urea |
|---|---|
| PubChem CID | 83112049 |
| Molecular Formula | C10H15N7O2 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 1,1-dimethyl-3-[2-[(3-oxo-2H-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]ethyl]urea |
| SMILES | CN(C)C(=O)NCCNc1ccc2n[nH]c(=O)n2n1 |
| InChI | InChI=1S/C10H15N7O2/c1-16(2)9(18)12-6-5-11-7-3-4-8-13-14-10(19)17(8)15-7/h3-4H,5-6H2,1-2H3,(H,11,15)(H,12,18)(H,14,19) |
| InChIKey | NOWHYWSCZANZOV-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|