C10H18N6O3 — CID 83112398
3-[2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]ethyl]-1,1-dimethylurea (PubChem CID 83112398) has the molecular formula C10H18N6O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is 3-[2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83112398 |
| Molecular Formula | C10H18N6O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 3-[2-[(2,4-dimethyl-3,5-dioxo-1,2,4-triazin-6-yl)amino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNc1nn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C10H18N6O3/c1-14(2)9(18)12-6-5-11-7-8(17)15(3)10(19)16(4)13-7/h5-6H2,1-4H3,(H,11,13)(H,12,18) |
| InChIKey | KKJADULOQDOOIP-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|