C9H11BrN6O — CID 83112416
2-[(8-bromo-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]ethylurea (PubChem CID 83112416) has the molecular formula C9H11BrN6O and a molecular weight of 299.13 g/mol. Its IUPAC name is 2-[(8-bromo-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]ethylurea.
| Compound Name | 2-[(8-bromo-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]ethylurea |
|---|---|
| PubChem CID | 83112416 |
| Molecular Formula | C9H11BrN6O |
| Molecular Weight | 299.13 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 2-[(8-bromo-[1,2,4]triazolo[1,5-a]pyridin-2-yl)amino]ethylurea |
| SMILES | NC(=O)NCCNc1nc2c(Br)cccn2n1 |
| InChI | InChI=1S/C9H11BrN6O/c10-6-2-1-5-16-7(6)14-9(15-16)13-4-3-12-8(11)17/h1-2,5H,3-4H2,(H,13,15)(H3,11,12,17) |
| InChIKey | FLJNPAQLBUPKON-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 97.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.13 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|