C9H16N4O5 — CID 83112729
(2S)-1-[2-(carbamoylamino)ethylcarbamoyl]-4-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 83112729) has the molecular formula C9H16N4O5 and a molecular weight of 260.25 g/mol. Its IUPAC name is (2S)-1-[2-(carbamoylamino)ethylcarbamoyl]-4-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[2-(carbamoylamino)ethylcarbamoyl]-4-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 83112729 |
| Molecular Formula | C9H16N4O5 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | (2S)-1-[2-(carbamoylamino)ethylcarbamoyl]-4-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | NC(=O)NCCNC(=O)N1CC(O)C[C@H]1C(=O)O |
| InChI | InChI=1S/C9H16N4O5/c10-8(17)11-1-2-12-9(18)13-4-5(14)3-6(13)7(15)16/h5-6,14H,1-4H2,(H,12,18)(H,15,16)(H3,10,11,17)/t5?,6-/m0/s1 |
| InChIKey | CGQZWCQWDCLZFU-GDVGLLTNSA-N |
| XLogP | -2.12 |
| TPSA | 144.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|