C12H23N5O3 — CID 83112793
N-[2-(dimethylcarbamoylamino)ethyl]-1-(N'-hydroxycarbamimidoyl)cyclopentane-1-carboxamide (PubChem CID 83112793) has the molecular formula C12H23N5O3 and a molecular weight of 285.35 g/mol. Its IUPAC name is N-[2-(dimethylcarbamoylamino)ethyl]-1-(N'-hydroxycarbamimidoyl)cyclopentane-1-carboxamide.
| Compound Name | N-[2-(dimethylcarbamoylamino)ethyl]-1-(N'-hydroxycarbamimidoyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 83112793 |
| Molecular Formula | C12H23N5O3 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | N-[2-(dimethylcarbamoylamino)ethyl]-1-(N'-hydroxycarbamimidoyl)cyclopentane-1-carboxamide |
| SMILES | CN(C)C(=O)NCCNC(=O)C1(C(N)=NO)CCCC1 |
| InChI | InChI=1S/C12H23N5O3/c1-17(2)11(19)15-8-7-14-10(18)12(9(13)16-20)5-3-4-6-12/h20H,3-8H2,1-2H3,(H2,13,16)(H,14,18)(H,15,19) |
| InChIKey | ZXLAYCQAMSZNKR-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 120.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|