C15H29N3O3 — CID 83113825
2-[[[1-(dimethylamino)cyclopentyl]methylcarbamoylamino]methyl]-2-methylbutanoic acid (PubChem CID 83113825) has the molecular formula C15H29N3O3 and a molecular weight of 299.42 g/mol. Its IUPAC name is 2-[[[1-(dimethylamino)cyclopentyl]methylcarbamoylamino]methyl]-2-methylbutanoic acid.
| Compound Name | 2-[[[1-(dimethylamino)cyclopentyl]methylcarbamoylamino]methyl]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 83113825 |
| Molecular Formula | C15H29N3O3 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | 2-[[[1-(dimethylamino)cyclopentyl]methylcarbamoylamino]methyl]-2-methylbutanoic acid |
| SMILES | CCC(C)(CNC(=O)NCC1(N(C)C)CCCC1)C(=O)O |
| InChI | InChI=1S/C15H29N3O3/c1-5-14(2,12(19)20)10-16-13(21)17-11-15(18(3)4)8-6-7-9-15/h5-11H2,1-4H3,(H,19,20)(H2,16,17,21) |
| InChIKey | QBGNAVSILYMWCM-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |