C13H24N4O4 — CID 83113849
1-[2-(carbamoylamino)ethylcarbamoylamino]-4-ethylcyclohexane-1-carboxylic acid (PubChem CID 83113849) has the molecular formula C13H24N4O4 and a molecular weight of 300.36 g/mol. Its IUPAC name is 1-[2-(carbamoylamino)ethylcarbamoylamino]-4-ethylcyclohexane-1-carboxylic acid.
| Compound Name | 1-[2-(carbamoylamino)ethylcarbamoylamino]-4-ethylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 83113849 |
| Molecular Formula | C13H24N4O4 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 1-[2-(carbamoylamino)ethylcarbamoylamino]-4-ethylcyclohexane-1-carboxylic acid |
| SMILES | CCC1CCC(NC(=O)NCCNC(N)=O)(C(=O)O)CC1 |
| InChI | InChI=1S/C13H24N4O4/c1-2-9-3-5-13(6-4-9,10(18)19)17-12(21)16-8-7-15-11(14)20/h9H,2-8H2,1H3,(H,18,19)(H3,14,15,20)(H2,16,17,21) |
| InChIKey | YIDZETUZMBCGPP-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|