C12H18FN5O2 — CID 83114769
N-[2-(dimethylcarbamoylamino)ethyl]-3-fluoro-2-hydrazinylbenzamide (PubChem CID 83114769) has the molecular formula C12H18FN5O2 and a molecular weight of 283.31 g/mol. Its IUPAC name is N-[2-(dimethylcarbamoylamino)ethyl]-3-fluoro-2-hydrazinylbenzamide.
| Compound Name | N-[2-(dimethylcarbamoylamino)ethyl]-3-fluoro-2-hydrazinylbenzamide |
|---|---|
| PubChem CID | 83114769 |
| Molecular Formula | C12H18FN5O2 |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-[2-(dimethylcarbamoylamino)ethyl]-3-fluoro-2-hydrazinylbenzamide |
| SMILES | CN(C)C(=O)NCCNC(=O)c1cccc(F)c1NN |
| InChI | InChI=1S/C12H18FN5O2/c1-18(2)12(20)16-7-6-15-11(19)8-4-3-5-9(13)10(8)17-14/h3-5,17H,6-7,14H2,1-2H3,(H,15,19)(H,16,20) |
| InChIKey | UEUKZTSXHMPUDT-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 99.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|