C12H19N5O2 — CID 83115001
N-[2-(carbamoylamino)ethyl]-4-(propylamino)pyridine-3-carboxamide (PubChem CID 83115001) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is N-[2-(carbamoylamino)ethyl]-4-(propylamino)pyridine-3-carboxamide.
| Compound Name | N-[2-(carbamoylamino)ethyl]-4-(propylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 83115001 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | N-[2-(carbamoylamino)ethyl]-4-(propylamino)pyridine-3-carboxamide |
| SMILES | CCCNc1ccncc1C(=O)NCCNC(N)=O |
| InChI | InChI=1S/C12H19N5O2/c1-2-4-15-10-3-5-14-8-9(10)11(18)16-6-7-17-12(13)19/h3,5,8H,2,4,6-7H2,1H3,(H,14,15)(H,16,18)(H3,13,17,19) |
| InChIKey | QOFILRMZZQBQBL-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 109.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|