C12H17N5O2S — CID 83115096
3-[2-(5-methoxy-2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)ethyl]-1,1-dimethylurea (PubChem CID 83115096) has the molecular formula C12H17N5O2S and a molecular weight of 295.37 g/mol. Its IUPAC name is 3-[2-(5-methoxy-2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-(5-methoxy-2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83115096 |
| Molecular Formula | C12H17N5O2S |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 3-[2-(5-methoxy-2-sulfanylidene-1H-imidazo[4,5-b]pyridin-3-yl)ethyl]-1,1-dimethylurea |
| SMILES | COc1ccc2[nH]c(=S)n(CCNC(=O)N(C)C)c2n1 |
| InChI | InChI=1S/C12H17N5O2S/c1-16(2)11(18)13-6-7-17-10-8(14-12(17)20)4-5-9(15-10)19-3/h4-5H,6-7H2,1-3H3,(H,13,18)(H,14,20) |
| InChIKey | SYVBEWCMNQITNB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 75.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|