C10H13N5O4 — CID 83115159
3-amino-N-[2-(carbamoylamino)ethyl]-2-nitrobenzamide (PubChem CID 83115159) has the molecular formula C10H13N5O4 and a molecular weight of 267.25 g/mol. Its IUPAC name is 3-amino-N-[2-(carbamoylamino)ethyl]-2-nitrobenzamide.
| Compound Name | 3-amino-N-[2-(carbamoylamino)ethyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 83115159 |
| Molecular Formula | C10H13N5O4 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 3-amino-N-[2-(carbamoylamino)ethyl]-2-nitrobenzamide |
| SMILES | NC(=O)NCCNC(=O)c1cccc(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H13N5O4/c11-7-3-1-2-6(8(7)15(18)19)9(16)13-4-5-14-10(12)17/h1-3H,4-5,11H2,(H,13,16)(H3,12,14,17) |
| InChIKey | XXQNWVHPGPOXJA-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 153.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|