C12H19N5O2 — CID 83116178
4-amino-3-[2-(carbamoylamino)ethylamino]-N-ethylbenzamide (PubChem CID 83116178) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 4-amino-3-[2-(carbamoylamino)ethylamino]-N-ethylbenzamide.
| Compound Name | 4-amino-3-[2-(carbamoylamino)ethylamino]-N-ethylbenzamide |
|---|---|
| PubChem CID | 83116178 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 4-amino-3-[2-(carbamoylamino)ethylamino]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccc(N)c(NCCNC(N)=O)c1 |
| InChI | InChI=1S/C12H19N5O2/c1-2-15-11(18)8-3-4-9(13)10(7-8)16-5-6-17-12(14)19/h3-4,7,16H,2,5-6,13H2,1H3,(H,15,18)(H3,14,17,19) |
| InChIKey | USUPUXRNQYEAGO-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|