C14H22FN3O2 — CID 83116462
3-[2-[1-(4-fluoro-3-methoxyphenyl)ethylamino]ethyl]-1,1-dimethylurea (PubChem CID 83116462) has the molecular formula C14H22FN3O2 and a molecular weight of 283.35 g/mol. Its IUPAC name is 3-[2-[1-(4-fluoro-3-methoxyphenyl)ethylamino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[1-(4-fluoro-3-methoxyphenyl)ethylamino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83116462 |
| Molecular Formula | C14H22FN3O2 |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 3-[2-[1-(4-fluoro-3-methoxyphenyl)ethylamino]ethyl]-1,1-dimethylurea |
| SMILES | COc1cc(C(C)NCCNC(=O)N(C)C)ccc1F |
| InChI | InChI=1S/C14H22FN3O2/c1-10(16-7-8-17-14(19)18(2)3)11-5-6-12(15)13(9-11)20-4/h5-6,9-10,16H,7-8H2,1-4H3,(H,17,19) |
| InChIKey | RGRCDZAHJPNTQY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|