C13H23N5O — CID 83117026
1,1-dimethyl-3-[2-[(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)amino]ethyl]urea (PubChem CID 83117026) has the molecular formula C13H23N5O and a molecular weight of 265.36 g/mol. Its IUPAC name is 1,1-dimethyl-3-[2-[(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)amino]ethyl]urea.
| Compound Name | 1,1-dimethyl-3-[2-[(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)amino]ethyl]urea |
|---|---|
| PubChem CID | 83117026 |
| Molecular Formula | C13H23N5O |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.19 |
| IUPAC Name | 1,1-dimethyl-3-[2-[(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)amino]ethyl]urea |
| SMILES | CN(C)C(=O)NCCNC1CCCc2c1cnn2C |
| InChI | InChI=1S/C13H23N5O/c1-17(2)13(19)15-8-7-14-11-5-4-6-12-10(11)9-16-18(12)3/h9,11,14H,4-8H2,1-3H3,(H,15,19) |
| InChIKey | WLURJTPIUAPAEM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|