C13H20N4O2 — CID 83117218
5-[[1-(dimethylamino)cyclopentyl]methylamino]pyrazine-2-carboxylic acid (PubChem CID 83117218) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 5-[[1-(dimethylamino)cyclopentyl]methylamino]pyrazine-2-carboxylic acid.
| Compound Name | 5-[[1-(dimethylamino)cyclopentyl]methylamino]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 83117218 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 5-[[1-(dimethylamino)cyclopentyl]methylamino]pyrazine-2-carboxylic acid |
| SMILES | CN(C)C1(CNc2cnc(C(=O)O)cn2)CCCC1 |
| InChI | InChI=1S/C13H20N4O2/c1-17(2)13(5-3-4-6-13)9-16-11-8-14-10(7-15-11)12(18)19/h7-8H,3-6,9H2,1-2H3,(H,15,16)(H,18,19) |
| InChIKey | GAZWFMDWPSCGHA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |