C10H16N8O — CID 83117480
3-[2-[(6-amino-1H-pyrazolo[5,4-d]pyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea (PubChem CID 83117480) has the molecular formula C10H16N8O and a molecular weight of 264.29 g/mol. Its IUPAC name is 3-[2-[(6-amino-1H-pyrazolo[5,4-d]pyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(6-amino-1H-pyrazolo[5,4-d]pyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83117480 |
| Molecular Formula | C10H16N8O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 3-[2-[(6-amino-1H-pyrazolo[5,4-d]pyrimidin-4-yl)amino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNc1nc(N)nc2[nH]ncc12 |
| InChI | InChI=1S/C10H16N8O/c1-18(2)10(19)13-4-3-12-7-6-5-14-17-8(6)16-9(11)15-7/h5H,3-4H2,1-2H3,(H,13,19)(H4,11,12,14,15,16,17) |
| InChIKey | BKKFFMMCTZQYMI-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 124.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|