C17H11Cl2NO3 — CID 831181
(4Z)-2-(2,4-dichlorophenyl)-4-[(3-methoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 831181) has the molecular formula C17H11Cl2NO3 and a molecular weight of 348.19 g/mol. Its IUPAC name is (4Z)-2-(2,4-dichlorophenyl)-4-[(3-methoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4Z)-2-(2,4-dichlorophenyl)-4-[(3-methoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 831181 |
| Molecular Formula | C17H11Cl2NO3 |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | (4Z)-2-(2,4-dichlorophenyl)-4-[(3-methoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | COc1cccc(/C=C2\N=C(c3ccc(Cl)cc3Cl)OC2=O)c1 |
| InChI | InChI=1S/C17H11Cl2NO3/c1-22-12-4-2-3-10(7-12)8-15-17(21)23-16(20-15)13-6-5-11(18)9-14(13)19/h2-9H,1H3/b15-8- |
| InChIKey | VYLAUBPVQFNHMX-NVNXTCNLSA-N |
| XLogP | 4.35 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|