C14H26N6O — CID 83118658
3-[2-[[6-(ethylamino)-5-propan-2-ylpyrimidin-4-yl]amino]ethyl]-1,1-dimethylurea (PubChem CID 83118658) has the molecular formula C14H26N6O and a molecular weight of 294.40 g/mol. Its IUPAC name is 3-[2-[[6-(ethylamino)-5-propan-2-ylpyrimidin-4-yl]amino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[[6-(ethylamino)-5-propan-2-ylpyrimidin-4-yl]amino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83118658 |
| Molecular Formula | C14H26N6O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 3-[2-[[6-(ethylamino)-5-propan-2-ylpyrimidin-4-yl]amino]ethyl]-1,1-dimethylurea |
| SMILES | CCNc1ncnc(NCCNC(=O)N(C)C)c1C(C)C |
| InChI | InChI=1S/C14H26N6O/c1-6-15-12-11(10(2)3)13(19-9-18-12)16-7-8-17-14(21)20(4)5/h9-10H,6-8H2,1-5H3,(H,17,21)(H2,15,16,18,19) |
| InChIKey | GVTWRRFSBCCIOQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|