C16H27FN4 — CID 83118931
N-[1-(5-fluoro-2-pyridinyl)ethyl]-2-methyl-2-(4-methylpiperazin-1-yl)propan-1-amine (PubChem CID 83118931) has the molecular formula C16H27FN4 and a molecular weight of 294.42 g/mol. Its IUPAC name is N-[1-(5-fluoro-2-pyridinyl)ethyl]-2-methyl-2-(4-methylpiperazin-1-yl)propan-1-amine.
| Compound Name | N-[1-(5-fluoro-2-pyridinyl)ethyl]-2-methyl-2-(4-methylpiperazin-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 83118931 |
| Molecular Formula | C16H27FN4 |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | N-[1-(5-fluoro-2-pyridinyl)ethyl]-2-methyl-2-(4-methylpiperazin-1-yl)propan-1-amine |
| SMILES | CC(NCC(C)(C)N1CCN(C)CC1)c1ccc(F)cn1 |
| InChI | InChI=1S/C16H27FN4/c1-13(15-6-5-14(17)11-18-15)19-12-16(2,3)21-9-7-20(4)8-10-21/h5-6,11,13,19H,7-10,12H2,1-4H3 |
| InChIKey | LNRLYZJLTMCLDH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |