C12H13N3O3 — CID 83119029
4-(6-acetyl-3-pyridinyl)-3-methylpiperazine-2,6-dione (PubChem CID 83119029) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 4-(6-acetyl-3-pyridinyl)-3-methylpiperazine-2,6-dione.
| Compound Name | 4-(6-acetyl-3-pyridinyl)-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 83119029 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 4-(6-acetyl-3-pyridinyl)-3-methylpiperazine-2,6-dione |
| SMILES | CC(=O)c1ccc(N2CC(=O)NC(=O)C2C)cn1 |
| InChI | InChI=1S/C12H13N3O3/c1-7-12(18)14-11(17)6-15(7)9-3-4-10(8(2)16)13-5-9/h3-5,7H,6H2,1-2H3,(H,14,17,18) |
| InChIKey | YAWQSMFXIYAWSE-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|