About 2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethylurea
2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethylurea (PubChem CID 83120369) has the molecular formula C7H14N4O
and a molecular weight of 170.22 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethylurea.
Molecular Properties
| Compound Name | 2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethylurea |
| PubChem CID | 83120369 |
| Molecular Formula | C7H14N4O |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.12 |
| IUPAC Name | 2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethylurea |
| SMILES | NC(=O)NCCNC1=NCCC1 |
| InChI | InChI=1S/C7H14N4O/c8-7(12)11-5-4-10-6-2-1-3-9-6/h1-5H2,(H,9,10)(H3,8,11,12) |
| InChIKey | HOAWQIPHYLFMTE-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethylurea?
The IUPAC name of 2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethylurea (CID 83120369) is 2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethylurea.
What is the SMILES notation for 2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethylurea?
The canonical SMILES for 2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethylurea is NC(=O)NCCNC1=NCCC1.
What is the InChIKey of 2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethylurea?
The InChIKey is HOAWQIPHYLFMTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4O/c8-7(12)11-5-4-10-6-2-1-3-9-6/h1-5H2,(H,9,10)(H3,8,11,12).
What are the key properties of 2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethylurea?
2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethylurea has a molecular weight of 170.22 g/mol, XLogP of -0.56, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dihydro-2H-pyrrol-5-ylamino)ethylurea is sourced from PubChem (CID 83120369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).