C8H16F3N3O2 — CID 83121670
1,1-dimethyl-3-[2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]ethyl]urea (PubChem CID 83121670) has the molecular formula C8H16F3N3O2 and a molecular weight of 243.23 g/mol. Its IUPAC name is 1,1-dimethyl-3-[2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]ethyl]urea.
| Compound Name | 1,1-dimethyl-3-[2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]ethyl]urea |
|---|---|
| PubChem CID | 83121670 |
| Molecular Formula | C8H16F3N3O2 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 1,1-dimethyl-3-[2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]ethyl]urea |
| SMILES | CN(C)C(=O)NCCNCC(O)C(F)(F)F |
| InChI | InChI=1S/C8H16F3N3O2/c1-14(2)7(16)13-4-3-12-5-6(15)8(9,10)11/h6,12,15H,3-5H2,1-2H3,(H,13,16) |
| InChIKey | OPAHCEBCAIXIAZ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|