C11H15F3N2O — CID 83123240
(1R)-1-[5-(4,4,4-trifluorobutoxy)-2-pyridinyl]ethanamine (PubChem CID 83123240) has the molecular formula C11H15F3N2O and a molecular weight of 248.25 g/mol. Its IUPAC name is (1R)-1-[5-(4,4,4-trifluorobutoxy)-2-pyridinyl]ethanamine.
| Compound Name | (1R)-1-[5-(4,4,4-trifluorobutoxy)-2-pyridinyl]ethanamine |
|---|---|
| PubChem CID | 83123240 |
| Molecular Formula | C11H15F3N2O |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | (1R)-1-[5-(4,4,4-trifluorobutoxy)-2-pyridinyl]ethanamine |
| SMILES | C[C@@H](N)c1ccc(OCCCC(F)(F)F)cn1 |
| InChI | InChI=1S/C11H15F3N2O/c1-8(15)10-4-3-9(7-16-10)17-6-2-5-11(12,13)14/h3-4,7-8H,2,5-6,15H2,1H3/t8-/m1/s1 |
| InChIKey | UVJBSLRWLGPRIT-MRVPVSSYSA-N |
| XLogP | 2.82 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|