About 1-[5-(2,5-dichlorophenyl)sulfanyl-2-pyridinyl]ethanamine
1-[5-(2,5-dichlorophenyl)sulfanyl-2-pyridinyl]ethanamine (PubChem CID 83123407) has the molecular formula C13H12Cl2N2S
and a molecular weight of 299.23 g/mol. Its IUPAC name is 1-[5-(2,5-dichlorophenyl)sulfanyl-2-pyridinyl]ethanamine.
Molecular Properties
| Compound Name | 1-[5-(2,5-dichlorophenyl)sulfanyl-2-pyridinyl]ethanamine |
| PubChem CID | 83123407 |
| Molecular Formula | C13H12Cl2N2S |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 1-[5-(2,5-dichlorophenyl)sulfanyl-2-pyridinyl]ethanamine |
| SMILES | CC(N)c1ccc(Sc2cc(Cl)ccc2Cl)cn1 |
| InChI | InChI=1S/C13H12Cl2N2S/c1-8(16)12-5-3-10(7-17-12)18-13-6-9(14)2-4-11(13)15/h2-8H,16H2,1H3 |
| InChIKey | ATVPXZNVIXYQBE-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[5-(2,5-dichlorophenyl)sulfanyl-2-pyridinyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(2,5-dichlorophenyl)sulfanyl-2-pyridinyl]ethanamine?
The IUPAC name of 1-[5-(2,5-dichlorophenyl)sulfanyl-2-pyridinyl]ethanamine (CID 83123407) is 1-[5-(2,5-dichlorophenyl)sulfanyl-2-pyridinyl]ethanamine.
What is the SMILES notation for 1-[5-(2,5-dichlorophenyl)sulfanyl-2-pyridinyl]ethanamine?
The canonical SMILES for 1-[5-(2,5-dichlorophenyl)sulfanyl-2-pyridinyl]ethanamine is CC(N)c1ccc(Sc2cc(Cl)ccc2Cl)cn1.
What is the InChIKey of 1-[5-(2,5-dichlorophenyl)sulfanyl-2-pyridinyl]ethanamine?
The InChIKey is ATVPXZNVIXYQBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12Cl2N2S/c1-8(16)12-5-3-10(7-17-12)18-13-6-9(14)2-4-11(13)15/h2-8H,16H2,1H3.
What are the key properties of 1-[5-(2,5-dichlorophenyl)sulfanyl-2-pyridinyl]ethanamine?
1-[5-(2,5-dichlorophenyl)sulfanyl-2-pyridinyl]ethanamine has a molecular weight of 299.23 g/mol, XLogP of 4.56, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(2,5-dichlorophenyl)sulfanyl-2-pyridinyl]ethanamine is sourced from PubChem (CID 83123407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).