About (1S)-1-[5-(3,3,5-trimethylcyclohexyl)oxy-2-pyridinyl]ethanamine
(1S)-1-[5-(3,3,5-trimethylcyclohexyl)oxy-2-pyridinyl]ethanamine (PubChem CID 83123915) has the molecular formula C16H26N2O
and a molecular weight of 262.40 g/mol. Its IUPAC name is (1S)-1-[5-(3,3,5-trimethylcyclohexyl)oxy-2-pyridinyl]ethanamine.
Molecular Properties
| Compound Name | (1S)-1-[5-(3,3,5-trimethylcyclohexyl)oxy-2-pyridinyl]ethanamine |
| PubChem CID | 83123915 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | (1S)-1-[5-(3,3,5-trimethylcyclohexyl)oxy-2-pyridinyl]ethanamine |
| SMILES | CC1CC(Oc2ccc([C@H](C)N)nc2)CC(C)(C)C1 |
| InChI | InChI=1S/C16H26N2O/c1-11-7-14(9-16(3,4)8-11)19-13-5-6-15(12(2)17)18-10-13/h5-6,10-12,14H,7-9,17H2,1-4H3/t11?,12-,14?/m0/s1 |
| InChIKey | LKBYDJBMXIZMNK-LXVYMNJGSA-N |
| XLogP | 3.69 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S)-1-[5-(3,3,5-trimethylcyclohexyl)oxy-2-pyridinyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[5-(3,3,5-trimethylcyclohexyl)oxy-2-pyridinyl]ethanamine?
The IUPAC name of (1S)-1-[5-(3,3,5-trimethylcyclohexyl)oxy-2-pyridinyl]ethanamine (CID 83123915) is (1S)-1-[5-(3,3,5-trimethylcyclohexyl)oxy-2-pyridinyl]ethanamine.
What is the SMILES notation for (1S)-1-[5-(3,3,5-trimethylcyclohexyl)oxy-2-pyridinyl]ethanamine?
The canonical SMILES for (1S)-1-[5-(3,3,5-trimethylcyclohexyl)oxy-2-pyridinyl]ethanamine is CC1CC(Oc2ccc([C@H](C)N)nc2)CC(C)(C)C1.
What is the InChIKey of (1S)-1-[5-(3,3,5-trimethylcyclohexyl)oxy-2-pyridinyl]ethanamine?
The InChIKey is LKBYDJBMXIZMNK-LXVYMNJGSA-N. The full InChI is InChI=1S/C16H26N2O/c1-11-7-14(9-16(3,4)8-11)19-13-5-6-15(12(2)17)18-10-13/h5-6,10-12,14H,7-9,17H2,1-4H3/t11?,12-,14?/m0/s1.
What are the key properties of (1S)-1-[5-(3,3,5-trimethylcyclohexyl)oxy-2-pyridinyl]ethanamine?
(1S)-1-[5-(3,3,5-trimethylcyclohexyl)oxy-2-pyridinyl]ethanamine has a molecular weight of 262.40 g/mol, XLogP of 3.69, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[5-(3,3,5-trimethylcyclohexyl)oxy-2-pyridinyl]ethanamine is sourced from PubChem (CID 83123915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).