About 1-[5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-pyridinyl]ethanamine
1-[5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-pyridinyl]ethanamine (PubChem CID 83124392) has the molecular formula C10H12N4OS
and a molecular weight of 236.30 g/mol. Its IUPAC name is 1-[5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-pyridinyl]ethanamine.
Molecular Properties
| Compound Name | 1-[5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-pyridinyl]ethanamine |
| PubChem CID | 83124392 |
| Molecular Formula | C10H12N4OS |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 1-[5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-pyridinyl]ethanamine |
| SMILES | Cc1nnc(Sc2ccc(C(C)N)nc2)o1 |
| InChI | InChI=1S/C10H12N4OS/c1-6(11)9-4-3-8(5-12-9)16-10-14-13-7(2)15-10/h3-6H,11H2,1-2H3 |
| InChIKey | HTJFTDDDMIIPII-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-pyridinyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-pyridinyl]ethanamine?
The IUPAC name of 1-[5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-pyridinyl]ethanamine (CID 83124392) is 1-[5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-pyridinyl]ethanamine.
What is the SMILES notation for 1-[5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-pyridinyl]ethanamine?
The canonical SMILES for 1-[5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-pyridinyl]ethanamine is Cc1nnc(Sc2ccc(C(C)N)nc2)o1.
What is the InChIKey of 1-[5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-pyridinyl]ethanamine?
The InChIKey is HTJFTDDDMIIPII-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4OS/c1-6(11)9-4-3-8(5-12-9)16-10-14-13-7(2)15-10/h3-6H,11H2,1-2H3.
What are the key properties of 1-[5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-pyridinyl]ethanamine?
1-[5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-pyridinyl]ethanamine has a molecular weight of 236.30 g/mol, XLogP of 1.94, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-2-pyridinyl]ethanamine is sourced from PubChem (CID 83124392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).