C13H21FN2 — CID 83124633
2-(5-fluoro-2-pyridinyl)-5,5-dimethylhexan-2-amine (PubChem CID 83124633) has the molecular formula C13H21FN2 and a molecular weight of 224.32 g/mol. Its IUPAC name is 2-(5-fluoro-2-pyridinyl)-5,5-dimethylhexan-2-amine.
| Compound Name | 2-(5-fluoro-2-pyridinyl)-5,5-dimethylhexan-2-amine |
|---|---|
| PubChem CID | 83124633 |
| Molecular Formula | C13H21FN2 |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | 2-(5-fluoro-2-pyridinyl)-5,5-dimethylhexan-2-amine |
| SMILES | CC(C)(C)CCC(C)(N)c1ccc(F)cn1 |
| InChI | InChI=1S/C13H21FN2/c1-12(2,3)7-8-13(4,15)11-6-5-10(14)9-16-11/h5-6,9H,7-8,15H2,1-4H3 |
| InChIKey | CEVXOQBYNJIJNW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |