About 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1-(5-fluoro-2-pyridinyl)propan-1-one
3-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1-(5-fluoro-2-pyridinyl)propan-1-one (PubChem CID 83126268) has the molecular formula C13H14F4N2O
and a molecular weight of 290.26 g/mol. Its IUPAC name is 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1-(5-fluoro-2-pyridinyl)propan-1-one.
Molecular Properties
| Compound Name | 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1-(5-fluoro-2-pyridinyl)propan-1-one |
| PubChem CID | 83126268 |
| Molecular Formula | C13H14F4N2O |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1-(5-fluoro-2-pyridinyl)propan-1-one |
| SMILES | O=C(CCN(CC(F)(F)F)C1CC1)c1ccc(F)cn1 |
| InChI | InChI=1S/C13H14F4N2O/c14-9-1-4-11(18-7-9)12(20)5-6-19(10-2-3-10)8-13(15,16)17/h1,4,7,10H,2-3,5-6,8H2 |
| InChIKey | PMPFNMBRBRJSGM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1-(5-fluoro-2-pyridinyl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1-(5-fluoro-2-pyridinyl)propan-1-one?
The IUPAC name of 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1-(5-fluoro-2-pyridinyl)propan-1-one (CID 83126268) is 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1-(5-fluoro-2-pyridinyl)propan-1-one.
What is the SMILES notation for 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1-(5-fluoro-2-pyridinyl)propan-1-one?
The canonical SMILES for 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1-(5-fluoro-2-pyridinyl)propan-1-one is O=C(CCN(CC(F)(F)F)C1CC1)c1ccc(F)cn1.
What is the InChIKey of 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1-(5-fluoro-2-pyridinyl)propan-1-one?
The InChIKey is PMPFNMBRBRJSGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F4N2O/c14-9-1-4-11(18-7-9)12(20)5-6-19(10-2-3-10)8-13(15,16)17/h1,4,7,10H,2-3,5-6,8H2.
What are the key properties of 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1-(5-fluoro-2-pyridinyl)propan-1-one?
3-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1-(5-fluoro-2-pyridinyl)propan-1-one has a molecular weight of 290.26 g/mol, XLogP of 2.82, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[cyclopropyl(2,2,2-trifluoroethyl)amino]-1-(5-fluoro-2-pyridinyl)propan-1-one is sourced from PubChem (CID 83126268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).