C15H25FN4 — CID 83126722
3-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]-1-(5-fluoro-2-pyridinyl)propan-1-amine (PubChem CID 83126722) has the molecular formula C15H25FN4 and a molecular weight of 280.39 g/mol. Its IUPAC name is 3-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]-1-(5-fluoro-2-pyridinyl)propan-1-amine.
| Compound Name | 3-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]-1-(5-fluoro-2-pyridinyl)propan-1-amine |
|---|---|
| PubChem CID | 83126722 |
| Molecular Formula | C15H25FN4 |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.21 |
| IUPAC Name | 3-[2-[(dimethylamino)methyl]pyrrolidin-1-yl]-1-(5-fluoro-2-pyridinyl)propan-1-amine |
| SMILES | CN(C)CC1CCCN1CCC(N)c1ccc(F)cn1 |
| InChI | InChI=1S/C15H25FN4/c1-19(2)11-13-4-3-8-20(13)9-7-14(17)15-6-5-12(16)10-18-15/h5-6,10,13-14H,3-4,7-9,11,17H2,1-2H3 |
| InChIKey | JYZAEORROGUWPE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |