About 6-[(1R)-1-aminoethyl]-N,N-bis(cyclopropylmethyl)pyridin-3-amine
6-[(1R)-1-aminoethyl]-N,N-bis(cyclopropylmethyl)pyridin-3-amine (PubChem CID 83127549) has the molecular formula C15H23N3
and a molecular weight of 245.37 g/mol. Its IUPAC name is 6-[(1R)-1-aminoethyl]-N,N-bis(cyclopropylmethyl)pyridin-3-amine.
Molecular Properties
| Compound Name | 6-[(1R)-1-aminoethyl]-N,N-bis(cyclopropylmethyl)pyridin-3-amine |
| PubChem CID | 83127549 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 6-[(1R)-1-aminoethyl]-N,N-bis(cyclopropylmethyl)pyridin-3-amine |
| SMILES | C[C@@H](N)c1ccc(N(CC2CC2)CC2CC2)cn1 |
| InChI | InChI=1S/C15H23N3/c1-11(16)15-7-6-14(8-17-15)18(9-12-2-3-12)10-13-4-5-13/h6-8,11-13H,2-5,9-10,16H2,1H3/t11-/m1/s1 |
| InChIKey | HWSHEPKNZSLEFI-LLVKDONJSA-N |
| XLogP | 2.73 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-[(1R)-1-aminoethyl]-N,N-bis(cyclopropylmethyl)pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(1R)-1-aminoethyl]-N,N-bis(cyclopropylmethyl)pyridin-3-amine?
The IUPAC name of 6-[(1R)-1-aminoethyl]-N,N-bis(cyclopropylmethyl)pyridin-3-amine (CID 83127549) is 6-[(1R)-1-aminoethyl]-N,N-bis(cyclopropylmethyl)pyridin-3-amine.
What is the SMILES notation for 6-[(1R)-1-aminoethyl]-N,N-bis(cyclopropylmethyl)pyridin-3-amine?
The canonical SMILES for 6-[(1R)-1-aminoethyl]-N,N-bis(cyclopropylmethyl)pyridin-3-amine is C[C@@H](N)c1ccc(N(CC2CC2)CC2CC2)cn1.
What is the InChIKey of 6-[(1R)-1-aminoethyl]-N,N-bis(cyclopropylmethyl)pyridin-3-amine?
The InChIKey is HWSHEPKNZSLEFI-LLVKDONJSA-N. The full InChI is InChI=1S/C15H23N3/c1-11(16)15-7-6-14(8-17-15)18(9-12-2-3-12)10-13-4-5-13/h6-8,11-13H,2-5,9-10,16H2,1H3/t11-/m1/s1.
What are the key properties of 6-[(1R)-1-aminoethyl]-N,N-bis(cyclopropylmethyl)pyridin-3-amine?
6-[(1R)-1-aminoethyl]-N,N-bis(cyclopropylmethyl)pyridin-3-amine has a molecular weight of 245.37 g/mol, XLogP of 2.73, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(1R)-1-aminoethyl]-N,N-bis(cyclopropylmethyl)pyridin-3-amine is sourced from PubChem (CID 83127549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).