About methyl 1-[6-[1-(ethylamino)ethyl]-3-pyridinyl]-1,2,4-triazole-3-carboxylate
methyl 1-[6-[1-(ethylamino)ethyl]-3-pyridinyl]-1,2,4-triazole-3-carboxylate (PubChem CID 83127672) has the molecular formula C13H17N5O2
and a molecular weight of 275.31 g/mol. Its IUPAC name is methyl 1-[6-[1-(ethylamino)ethyl]-3-pyridinyl]-1,2,4-triazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[6-[1-(ethylamino)ethyl]-3-pyridinyl]-1,2,4-triazole-3-carboxylate |
| PubChem CID | 83127672 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | methyl 1-[6-[1-(ethylamino)ethyl]-3-pyridinyl]-1,2,4-triazole-3-carboxylate |
| SMILES | CCNC(C)c1ccc(-n2cnc(C(=O)OC)n2)cn1 |
| InChI | InChI=1S/C13H17N5O2/c1-4-14-9(2)11-6-5-10(7-15-11)18-8-16-12(17-18)13(19)20-3/h5-9,14H,4H2,1-3H3 |
| InChIKey | BCFLDFOORREGTJ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 1-[6-[1-(ethylamino)ethyl]-3-pyridinyl]-1,2,4-triazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[6-[1-(ethylamino)ethyl]-3-pyridinyl]-1,2,4-triazole-3-carboxylate?
The IUPAC name of methyl 1-[6-[1-(ethylamino)ethyl]-3-pyridinyl]-1,2,4-triazole-3-carboxylate (CID 83127672) is methyl 1-[6-[1-(ethylamino)ethyl]-3-pyridinyl]-1,2,4-triazole-3-carboxylate.
What is the SMILES notation for methyl 1-[6-[1-(ethylamino)ethyl]-3-pyridinyl]-1,2,4-triazole-3-carboxylate?
The canonical SMILES for methyl 1-[6-[1-(ethylamino)ethyl]-3-pyridinyl]-1,2,4-triazole-3-carboxylate is CCNC(C)c1ccc(-n2cnc(C(=O)OC)n2)cn1.
What is the InChIKey of methyl 1-[6-[1-(ethylamino)ethyl]-3-pyridinyl]-1,2,4-triazole-3-carboxylate?
The InChIKey is BCFLDFOORREGTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N5O2/c1-4-14-9(2)11-6-5-10(7-15-11)18-8-16-12(17-18)13(19)20-3/h5-9,14H,4H2,1-3H3.
What are the key properties of methyl 1-[6-[1-(ethylamino)ethyl]-3-pyridinyl]-1,2,4-triazole-3-carboxylate?
methyl 1-[6-[1-(ethylamino)ethyl]-3-pyridinyl]-1,2,4-triazole-3-carboxylate has a molecular weight of 275.31 g/mol, XLogP of 1.12, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[6-[1-(ethylamino)ethyl]-3-pyridinyl]-1,2,4-triazole-3-carboxylate is sourced from PubChem (CID 83127672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).