C13H11Cl3N2O — CID 83127680
1-[5-(2,4,5-trichlorophenoxy)-2-pyridinyl]ethanamine (PubChem CID 83127680) has the molecular formula C13H11Cl3N2O and a molecular weight of 317.60 g/mol. Its IUPAC name is 1-[5-(2,4,5-trichlorophenoxy)-2-pyridinyl]ethanamine.
| Compound Name | 1-[5-(2,4,5-trichlorophenoxy)-2-pyridinyl]ethanamine |
|---|---|
| PubChem CID | 83127680 |
| Molecular Formula | C13H11Cl3N2O |
| Molecular Weight | 317.60 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | 1-[5-(2,4,5-trichlorophenoxy)-2-pyridinyl]ethanamine |
| SMILES | CC(N)c1ccc(Oc2cc(Cl)c(Cl)cc2Cl)cn1 |
| InChI | InChI=1S/C13H11Cl3N2O/c1-7(17)12-3-2-8(6-18-12)19-13-5-10(15)9(14)4-11(13)16/h2-7H,17H2,1H3 |
| InChIKey | ZFGPWHAPEXPAHX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|