About (1S)-1-[5-(1,3,4-thiadiazol-2-ylsulfanyl)-2-pyridinyl]ethanol
(1S)-1-[5-(1,3,4-thiadiazol-2-ylsulfanyl)-2-pyridinyl]ethanol (PubChem CID 83128395) has the molecular formula C9H9N3OS2
and a molecular weight of 239.33 g/mol. Its IUPAC name is (1S)-1-[5-(1,3,4-thiadiazol-2-ylsulfanyl)-2-pyridinyl]ethanol.
Molecular Properties
| Compound Name | (1S)-1-[5-(1,3,4-thiadiazol-2-ylsulfanyl)-2-pyridinyl]ethanol |
| PubChem CID | 83128395 |
| Molecular Formula | C9H9N3OS2 |
| Molecular Weight | 239.33 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | (1S)-1-[5-(1,3,4-thiadiazol-2-ylsulfanyl)-2-pyridinyl]ethanol |
| SMILES | C[C@H](O)c1ccc(Sc2nncs2)cn1 |
| InChI | InChI=1S/C9H9N3OS2/c1-6(13)8-3-2-7(4-10-8)15-9-12-11-5-14-9/h2-6,13H,1H3/t6-/m0/s1 |
| InChIKey | RBNAMPIVIICSNN-LURJTMIESA-N |
| XLogP | 2.14 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1S)-1-[5-(1,3,4-thiadiazol-2-ylsulfanyl)-2-pyridinyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[5-(1,3,4-thiadiazol-2-ylsulfanyl)-2-pyridinyl]ethanol?
The IUPAC name of (1S)-1-[5-(1,3,4-thiadiazol-2-ylsulfanyl)-2-pyridinyl]ethanol (CID 83128395) is (1S)-1-[5-(1,3,4-thiadiazol-2-ylsulfanyl)-2-pyridinyl]ethanol.
What is the SMILES notation for (1S)-1-[5-(1,3,4-thiadiazol-2-ylsulfanyl)-2-pyridinyl]ethanol?
The canonical SMILES for (1S)-1-[5-(1,3,4-thiadiazol-2-ylsulfanyl)-2-pyridinyl]ethanol is C[C@H](O)c1ccc(Sc2nncs2)cn1.
What is the InChIKey of (1S)-1-[5-(1,3,4-thiadiazol-2-ylsulfanyl)-2-pyridinyl]ethanol?
The InChIKey is RBNAMPIVIICSNN-LURJTMIESA-N. The full InChI is InChI=1S/C9H9N3OS2/c1-6(13)8-3-2-7(4-10-8)15-9-12-11-5-14-9/h2-6,13H,1H3/t6-/m0/s1.
What are the key properties of (1S)-1-[5-(1,3,4-thiadiazol-2-ylsulfanyl)-2-pyridinyl]ethanol?
(1S)-1-[5-(1,3,4-thiadiazol-2-ylsulfanyl)-2-pyridinyl]ethanol has a molecular weight of 239.33 g/mol, XLogP of 2.14, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[5-(1,3,4-thiadiazol-2-ylsulfanyl)-2-pyridinyl]ethanol is sourced from PubChem (CID 83128395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).