About 5-(5-fluoro-2-pyridinyl)-3,3-dimethylthiomorpholine
5-(5-fluoro-2-pyridinyl)-3,3-dimethylthiomorpholine (PubChem CID 83129132) has the molecular formula C11H15FN2S
and a molecular weight of 226.32 g/mol. Its IUPAC name is 5-(5-fluoro-2-pyridinyl)-3,3-dimethylthiomorpholine.
Molecular Properties
| Compound Name | 5-(5-fluoro-2-pyridinyl)-3,3-dimethylthiomorpholine |
| PubChem CID | 83129132 |
| Molecular Formula | C11H15FN2S |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 5-(5-fluoro-2-pyridinyl)-3,3-dimethylthiomorpholine |
| SMILES | CC1(C)CSCC(c2ccc(F)cn2)N1 |
| InChI | InChI=1S/C11H15FN2S/c1-11(2)7-15-6-10(14-11)9-4-3-8(12)5-13-9/h3-5,10,14H,6-7H2,1-2H3 |
| InChIKey | FYLLKLSKGOSPCW-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(5-fluoro-2-pyridinyl)-3,3-dimethylthiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-fluoro-2-pyridinyl)-3,3-dimethylthiomorpholine?
The IUPAC name of 5-(5-fluoro-2-pyridinyl)-3,3-dimethylthiomorpholine (CID 83129132) is 5-(5-fluoro-2-pyridinyl)-3,3-dimethylthiomorpholine.
What is the SMILES notation for 5-(5-fluoro-2-pyridinyl)-3,3-dimethylthiomorpholine?
The canonical SMILES for 5-(5-fluoro-2-pyridinyl)-3,3-dimethylthiomorpholine is CC1(C)CSCC(c2ccc(F)cn2)N1.
What is the InChIKey of 5-(5-fluoro-2-pyridinyl)-3,3-dimethylthiomorpholine?
The InChIKey is FYLLKLSKGOSPCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15FN2S/c1-11(2)7-15-6-10(14-11)9-4-3-8(12)5-13-9/h3-5,10,14H,6-7H2,1-2H3.
What are the key properties of 5-(5-fluoro-2-pyridinyl)-3,3-dimethylthiomorpholine?
5-(5-fluoro-2-pyridinyl)-3,3-dimethylthiomorpholine has a molecular weight of 226.32 g/mol, XLogP of 2.38, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-fluoro-2-pyridinyl)-3,3-dimethylthiomorpholine is sourced from PubChem (CID 83129132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).