About 2-fluoro-4-(2,4,5-trimethylphenyl)phenol
2-fluoro-4-(2,4,5-trimethylphenyl)phenol (PubChem CID 83130451) has the molecular formula C15H15FO
and a molecular weight of 230.28 g/mol. Its IUPAC name is 2-fluoro-4-(2,4,5-trimethylphenyl)phenol.
Molecular Properties
| Compound Name | 2-fluoro-4-(2,4,5-trimethylphenyl)phenol |
| PubChem CID | 83130451 |
| Molecular Formula | C15H15FO |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2-fluoro-4-(2,4,5-trimethylphenyl)phenol |
| SMILES | Cc1cc(C)c(-c2ccc(O)c(F)c2)cc1C |
| InChI | InChI=1S/C15H15FO/c1-9-6-11(3)13(7-10(9)2)12-4-5-15(17)14(16)8-12/h4-8,17H,1-3H3 |
| InChIKey | NNEODALZQDWYMJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-fluoro-4-(2,4,5-trimethylphenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-(2,4,5-trimethylphenyl)phenol?
The IUPAC name of 2-fluoro-4-(2,4,5-trimethylphenyl)phenol (CID 83130451) is 2-fluoro-4-(2,4,5-trimethylphenyl)phenol.
What is the SMILES notation for 2-fluoro-4-(2,4,5-trimethylphenyl)phenol?
The canonical SMILES for 2-fluoro-4-(2,4,5-trimethylphenyl)phenol is Cc1cc(C)c(-c2ccc(O)c(F)c2)cc1C.
What is the InChIKey of 2-fluoro-4-(2,4,5-trimethylphenyl)phenol?
The InChIKey is NNEODALZQDWYMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15FO/c1-9-6-11(3)13(7-10(9)2)12-4-5-15(17)14(16)8-12/h4-8,17H,1-3H3.
What are the key properties of 2-fluoro-4-(2,4,5-trimethylphenyl)phenol?
2-fluoro-4-(2,4,5-trimethylphenyl)phenol has a molecular weight of 230.28 g/mol, XLogP of 4.12, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-(2,4,5-trimethylphenyl)phenol is sourced from PubChem (CID 83130451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).