About 1-(3-amino-1,1,1-trifluoropropan-2-yl)-5-bromo-3-methylpyridin-2-one
1-(3-amino-1,1,1-trifluoropropan-2-yl)-5-bromo-3-methylpyridin-2-one (PubChem CID 83130606) has the molecular formula C9H10BrF3N2O
and a molecular weight of 299.09 g/mol. Its IUPAC name is 1-(3-amino-1,1,1-trifluoropropan-2-yl)-5-bromo-3-methylpyridin-2-one.
Molecular Properties
| Compound Name | 1-(3-amino-1,1,1-trifluoropropan-2-yl)-5-bromo-3-methylpyridin-2-one |
| PubChem CID | 83130606 |
| Molecular Formula | C9H10BrF3N2O |
| Molecular Weight | 299.09 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 1-(3-amino-1,1,1-trifluoropropan-2-yl)-5-bromo-3-methylpyridin-2-one |
| SMILES | Cc1cc(Br)cn(C(CN)C(F)(F)F)c1=O |
| InChI | InChI=1S/C9H10BrF3N2O/c1-5-2-6(10)4-15(8(5)16)7(3-14)9(11,12)13/h2,4,7H,3,14H2,1H3 |
| InChIKey | DUXJYFSKSRWVLZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.09 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-amino-1,1,1-trifluoropropan-2-yl)-5-bromo-3-methylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-amino-1,1,1-trifluoropropan-2-yl)-5-bromo-3-methylpyridin-2-one?
The IUPAC name of 1-(3-amino-1,1,1-trifluoropropan-2-yl)-5-bromo-3-methylpyridin-2-one (CID 83130606) is 1-(3-amino-1,1,1-trifluoropropan-2-yl)-5-bromo-3-methylpyridin-2-one.
What is the SMILES notation for 1-(3-amino-1,1,1-trifluoropropan-2-yl)-5-bromo-3-methylpyridin-2-one?
The canonical SMILES for 1-(3-amino-1,1,1-trifluoropropan-2-yl)-5-bromo-3-methylpyridin-2-one is Cc1cc(Br)cn(C(CN)C(F)(F)F)c1=O.
What is the InChIKey of 1-(3-amino-1,1,1-trifluoropropan-2-yl)-5-bromo-3-methylpyridin-2-one?
The InChIKey is DUXJYFSKSRWVLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrF3N2O/c1-5-2-6(10)4-15(8(5)16)7(3-14)9(11,12)13/h2,4,7H,3,14H2,1H3.
What are the key properties of 1-(3-amino-1,1,1-trifluoropropan-2-yl)-5-bromo-3-methylpyridin-2-one?
1-(3-amino-1,1,1-trifluoropropan-2-yl)-5-bromo-3-methylpyridin-2-one has a molecular weight of 299.09 g/mol, XLogP of 1.98, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-amino-1,1,1-trifluoropropan-2-yl)-5-bromo-3-methylpyridin-2-one is sourced from PubChem (CID 83130606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).