C11H14N2O — CID 83132268
(1S)-1-[5-[methyl(prop-2-ynyl)amino]-2-pyridinyl]ethanol (PubChem CID 83132268) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is (1S)-1-[5-[methyl(prop-2-ynyl)amino]-2-pyridinyl]ethanol.
| Compound Name | (1S)-1-[5-[methyl(prop-2-ynyl)amino]-2-pyridinyl]ethanol |
|---|---|
| PubChem CID | 83132268 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | (1S)-1-[5-[methyl(prop-2-ynyl)amino]-2-pyridinyl]ethanol |
| SMILES | C#CCN(C)c1ccc([C@H](C)O)nc1 |
| InChI | InChI=1S/C11H14N2O/c1-4-7-13(3)10-5-6-11(9(2)14)12-8-10/h1,5-6,8-9,14H,7H2,2-3H3/t9-/m0/s1 |
| InChIKey | FESJCDNEVSYZGO-VIFPVBQESA-N |
| XLogP | 1.20 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|