About (1R)-1-[5-(N,3-dimethylanilino)-2-pyridinyl]ethanol
(1R)-1-[5-(N,3-dimethylanilino)-2-pyridinyl]ethanol (PubChem CID 83132483) has the molecular formula C15H18N2O
and a molecular weight of 242.32 g/mol. Its IUPAC name is (1R)-1-[5-(N,3-dimethylanilino)-2-pyridinyl]ethanol.
Molecular Properties
| Compound Name | (1R)-1-[5-(N,3-dimethylanilino)-2-pyridinyl]ethanol |
| PubChem CID | 83132483 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | (1R)-1-[5-(N,3-dimethylanilino)-2-pyridinyl]ethanol |
| SMILES | Cc1cccc(N(C)c2ccc([C@@H](C)O)nc2)c1 |
| InChI | InChI=1S/C15H18N2O/c1-11-5-4-6-13(9-11)17(3)14-7-8-15(12(2)18)16-10-14/h4-10,12,18H,1-3H3/t12-/m1/s1 |
| InChIKey | BRAZRTFFOJGWTB-GFCCVEGCSA-N |
| XLogP | 3.21 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R)-1-[5-(N,3-dimethylanilino)-2-pyridinyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[5-(N,3-dimethylanilino)-2-pyridinyl]ethanol?
The IUPAC name of (1R)-1-[5-(N,3-dimethylanilino)-2-pyridinyl]ethanol (CID 83132483) is (1R)-1-[5-(N,3-dimethylanilino)-2-pyridinyl]ethanol.
What is the SMILES notation for (1R)-1-[5-(N,3-dimethylanilino)-2-pyridinyl]ethanol?
The canonical SMILES for (1R)-1-[5-(N,3-dimethylanilino)-2-pyridinyl]ethanol is Cc1cccc(N(C)c2ccc([C@@H](C)O)nc2)c1.
What is the InChIKey of (1R)-1-[5-(N,3-dimethylanilino)-2-pyridinyl]ethanol?
The InChIKey is BRAZRTFFOJGWTB-GFCCVEGCSA-N. The full InChI is InChI=1S/C15H18N2O/c1-11-5-4-6-13(9-11)17(3)14-7-8-15(12(2)18)16-10-14/h4-10,12,18H,1-3H3/t12-/m1/s1.
What are the key properties of (1R)-1-[5-(N,3-dimethylanilino)-2-pyridinyl]ethanol?
(1R)-1-[5-(N,3-dimethylanilino)-2-pyridinyl]ethanol has a molecular weight of 242.32 g/mol, XLogP of 3.21, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[5-(N,3-dimethylanilino)-2-pyridinyl]ethanol is sourced from PubChem (CID 83132483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).