C10H12BrF3N2O — CID 83133226
5-bromo-3-methyl-1-[2-(2,2,2-trifluoroethylamino)ethyl]pyridin-2-one (PubChem CID 83133226) has the molecular formula C10H12BrF3N2O and a molecular weight of 313.12 g/mol. Its IUPAC name is 5-bromo-3-methyl-1-[2-(2,2,2-trifluoroethylamino)ethyl]pyridin-2-one.
| Compound Name | 5-bromo-3-methyl-1-[2-(2,2,2-trifluoroethylamino)ethyl]pyridin-2-one |
|---|---|
| PubChem CID | 83133226 |
| Molecular Formula | C10H12BrF3N2O |
| Molecular Weight | 313.12 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 5-bromo-3-methyl-1-[2-(2,2,2-trifluoroethylamino)ethyl]pyridin-2-one |
| SMILES | Cc1cc(Br)cn(CCNCC(F)(F)F)c1=O |
| InChI | InChI=1S/C10H12BrF3N2O/c1-7-4-8(11)5-16(9(7)17)3-2-15-6-10(12,13)14/h4-5,15H,2-3,6H2,1H3 |
| InChIKey | ZTEOATQHKTZTAB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.12 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|