C17H27ClN4O — CID 831338
4-chloro-N,N-dicyclohexyl-6-ethoxy-1,3,5-triazin-2-amine (PubChem CID 831338) has the molecular formula C17H27ClN4O and a molecular weight of 338.88 g/mol. Its IUPAC name is 4-chloro-N,N-dicyclohexyl-6-ethoxy-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N,N-dicyclohexyl-6-ethoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 831338 |
| Molecular Formula | C17H27ClN4O |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 4-chloro-N,N-dicyclohexyl-6-ethoxy-1,3,5-triazin-2-amine |
| SMILES | CCOc1nc(Cl)nc(N(C2CCCCC2)C2CCCCC2)n1 |
| InChI | InChI=1S/C17H27ClN4O/c1-2-23-17-20-15(18)19-16(21-17)22(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h13-14H,2-12H2,1H3 |
| InChIKey | RBSQTQSVVPTLFX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |