C18H18O2 — CID 83134790
4-(2-methyl-4-phenylmethoxyphenyl)but-3-yn-1-ol (PubChem CID 83134790) has the molecular formula C18H18O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 4-(2-methyl-4-phenylmethoxyphenyl)but-3-yn-1-ol.
| Compound Name | 4-(2-methyl-4-phenylmethoxyphenyl)but-3-yn-1-ol |
|---|---|
| PubChem CID | 83134790 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 4-(2-methyl-4-phenylmethoxyphenyl)but-3-yn-1-ol |
| SMILES | Cc1cc(OCc2ccccc2)ccc1C#CCCO |
| InChI | InChI=1S/C18H18O2/c1-15-13-18(11-10-17(15)9-5-6-12-19)20-14-16-7-3-2-4-8-16/h2-4,7-8,10-11,13,19H,6,12,14H2,1H3 |
| InChIKey | HUWAGOYYSRPZCR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|