C14H17FN2OS2 — CID 83136542
N-(3-carbamothioyl-4-fluorophenyl)-2-(thian-4-yl)acetamide (PubChem CID 83136542) has the molecular formula C14H17FN2OS2 and a molecular weight of 312.44 g/mol. Its IUPAC name is N-(3-carbamothioyl-4-fluorophenyl)-2-(thian-4-yl)acetamide.
| Compound Name | N-(3-carbamothioyl-4-fluorophenyl)-2-(thian-4-yl)acetamide |
|---|---|
| PubChem CID | 83136542 |
| Molecular Formula | C14H17FN2OS2 |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | N-(3-carbamothioyl-4-fluorophenyl)-2-(thian-4-yl)acetamide |
| SMILES | NC(=S)c1cc(NC(=O)CC2CCSCC2)ccc1F |
| InChI | InChI=1S/C14H17FN2OS2/c15-12-2-1-10(8-11(12)14(16)19)17-13(18)7-9-3-5-20-6-4-9/h1-2,8-9H,3-7H2,(H2,16,19)(H,17,18) |
| InChIKey | PCHGSEWTLIJCOM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|