About N,N-dimethyl-2-(thian-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine
N,N-dimethyl-2-(thian-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine (PubChem CID 83136947) has the molecular formula C14H20N4S
and a molecular weight of 276.41 g/mol. Its IUPAC name is N,N-dimethyl-2-(thian-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine.
Molecular Properties
| Compound Name | N,N-dimethyl-2-(thian-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine |
| PubChem CID | 83136947 |
| Molecular Formula | C14H20N4S |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | N,N-dimethyl-2-(thian-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine |
| SMILES | CN(C)c1ccc2[nH]c(CC3CCSCC3)nc2n1 |
| InChI | InChI=1S/C14H20N4S/c1-18(2)13-4-3-11-14(17-13)16-12(15-11)9-10-5-7-19-8-6-10/h3-4,10H,5-9H2,1-2H3,(H,15,16,17) |
| InChIKey | ZANNJCLEZQFHFY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-dimethyl-2-(thian-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-2-(thian-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine?
The IUPAC name of N,N-dimethyl-2-(thian-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine (CID 83136947) is N,N-dimethyl-2-(thian-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine.
What is the SMILES notation for N,N-dimethyl-2-(thian-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine?
The canonical SMILES for N,N-dimethyl-2-(thian-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine is CN(C)c1ccc2[nH]c(CC3CCSCC3)nc2n1.
What is the InChIKey of N,N-dimethyl-2-(thian-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine?
The InChIKey is ZANNJCLEZQFHFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4S/c1-18(2)13-4-3-11-14(17-13)16-12(15-11)9-10-5-7-19-8-6-10/h3-4,10H,5-9H2,1-2H3,(H,15,16,17).
What are the key properties of N,N-dimethyl-2-(thian-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine?
N,N-dimethyl-2-(thian-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine has a molecular weight of 276.41 g/mol, XLogP of 2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-2-(thian-4-ylmethyl)-1H-imidazo[4,5-b]pyridin-5-amine is sourced from PubChem (CID 83136947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).