About potassium [4-(3,4-dimethylcyclohexyl)oxy-2-methylphenyl]-trifluoroboranuide
potassium [4-(3,4-dimethylcyclohexyl)oxy-2-methylphenyl]-trifluoroboranuide (PubChem CID 83137073) has the molecular formula C15H21BF3KO
and a molecular weight of 324.24 g/mol. Its IUPAC name is potassium [4-(3,4-dimethylcyclohexyl)oxy-2-methylphenyl]-trifluoroboranuide.
Molecular Properties
| Compound Name | potassium [4-(3,4-dimethylcyclohexyl)oxy-2-methylphenyl]-trifluoroboranuide |
| PubChem CID | 83137073 |
| Molecular Formula | C15H21BF3KO |
| Molecular Weight | 324.24 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | potassium [4-(3,4-dimethylcyclohexyl)oxy-2-methylphenyl]-trifluoroboranuide |
| SMILES | Cc1cc(OC2CCC(C)C(C)C2)ccc1[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C15H21BF3O.K/c1-10-4-5-13(8-11(10)2)20-14-6-7-15(12(3)9-14)16(17,18)19;/h6-7,9-11,13H,4-5,8H2,1-3H3;/q-1;+1 |
| InChIKey | KLVLPTSXYNENFM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium [4-(3,4-dimethylcyclohexyl)oxy-2-methylphenyl]-trifluoroboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium [4-(3,4-dimethylcyclohexyl)oxy-2-methylphenyl]-trifluoroboranuide?
The IUPAC name of potassium [4-(3,4-dimethylcyclohexyl)oxy-2-methylphenyl]-trifluoroboranuide (CID 83137073) is potassium [4-(3,4-dimethylcyclohexyl)oxy-2-methylphenyl]-trifluoroboranuide.
What is the SMILES notation for potassium [4-(3,4-dimethylcyclohexyl)oxy-2-methylphenyl]-trifluoroboranuide?
The canonical SMILES for potassium [4-(3,4-dimethylcyclohexyl)oxy-2-methylphenyl]-trifluoroboranuide is Cc1cc(OC2CCC(C)C(C)C2)ccc1[B-](F)(F)F.[K+].
What is the InChIKey of potassium [4-(3,4-dimethylcyclohexyl)oxy-2-methylphenyl]-trifluoroboranuide?
The InChIKey is KLVLPTSXYNENFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21BF3O.K/c1-10-4-5-13(8-11(10)2)20-14-6-7-15(12(3)9-14)16(17,18)19;/h6-7,9-11,13H,4-5,8H2,1-3H3;/q-1;+1.
What are the key properties of potassium [4-(3,4-dimethylcyclohexyl)oxy-2-methylphenyl]-trifluoroboranuide?
potassium [4-(3,4-dimethylcyclohexyl)oxy-2-methylphenyl]-trifluoroboranuide has a molecular weight of 324.24 g/mol, XLogP of 1.26, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium [4-(3,4-dimethylcyclohexyl)oxy-2-methylphenyl]-trifluoroboranuide is sourced from PubChem (CID 83137073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).