C14H28N2OS — CID 83138084
N-(1-amino-2,4-dimethylpentan-2-yl)-2-(thian-4-yl)acetamide (PubChem CID 83138084) has the molecular formula C14H28N2OS and a molecular weight of 272.46 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethylpentan-2-yl)-2-(thian-4-yl)acetamide.
| Compound Name | N-(1-amino-2,4-dimethylpentan-2-yl)-2-(thian-4-yl)acetamide |
|---|---|
| PubChem CID | 83138084 |
| Molecular Formula | C14H28N2OS |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | N-(1-amino-2,4-dimethylpentan-2-yl)-2-(thian-4-yl)acetamide |
| SMILES | CC(C)CC(C)(CN)NC(=O)CC1CCSCC1 |
| InChI | InChI=1S/C14H28N2OS/c1-11(2)9-14(3,10-15)16-13(17)8-12-4-6-18-7-5-12/h11-12H,4-10,15H2,1-3H3,(H,16,17) |
| InChIKey | YYIDXZXRRRJANR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |