About 2-[(3,5-dimethylphenyl)methyl]-3,3-dimethylbutan-1-ol
2-[(3,5-dimethylphenyl)methyl]-3,3-dimethylbutan-1-ol (PubChem CID 83138776) has the molecular formula C15H24O
and a molecular weight of 220.36 g/mol. Its IUPAC name is 2-[(3,5-dimethylphenyl)methyl]-3,3-dimethylbutan-1-ol.
Molecular Properties
| Compound Name | 2-[(3,5-dimethylphenyl)methyl]-3,3-dimethylbutan-1-ol |
| PubChem CID | 83138776 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 2-[(3,5-dimethylphenyl)methyl]-3,3-dimethylbutan-1-ol |
| SMILES | Cc1cc(C)cc(CC(CO)C(C)(C)C)c1 |
| InChI | InChI=1S/C15H24O/c1-11-6-12(2)8-13(7-11)9-14(10-16)15(3,4)5/h6-8,14,16H,9-10H2,1-5H3 |
| InChIKey | UVTSRGRSAHCNDK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[(3,5-dimethylphenyl)methyl]-3,3-dimethylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,5-dimethylphenyl)methyl]-3,3-dimethylbutan-1-ol?
The IUPAC name of 2-[(3,5-dimethylphenyl)methyl]-3,3-dimethylbutan-1-ol (CID 83138776) is 2-[(3,5-dimethylphenyl)methyl]-3,3-dimethylbutan-1-ol.
What is the SMILES notation for 2-[(3,5-dimethylphenyl)methyl]-3,3-dimethylbutan-1-ol?
The canonical SMILES for 2-[(3,5-dimethylphenyl)methyl]-3,3-dimethylbutan-1-ol is Cc1cc(C)cc(CC(CO)C(C)(C)C)c1.
What is the InChIKey of 2-[(3,5-dimethylphenyl)methyl]-3,3-dimethylbutan-1-ol?
The InChIKey is UVTSRGRSAHCNDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O/c1-11-6-12(2)8-13(7-11)9-14(10-16)15(3,4)5/h6-8,14,16H,9-10H2,1-5H3.
What are the key properties of 2-[(3,5-dimethylphenyl)methyl]-3,3-dimethylbutan-1-ol?
2-[(3,5-dimethylphenyl)methyl]-3,3-dimethylbutan-1-ol has a molecular weight of 220.36 g/mol, XLogP of 3.50, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dimethylphenyl)methyl]-3,3-dimethylbutan-1-ol is sourced from PubChem (CID 83138776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).